888CHEM
Japanese 
Korean 
Hindi 
Russian 
Arabic 
Malaysian 
Can't find the answer?
Ask a qualified mentor to answer
2,2-Dinitro -4,4-dichlorodiphenyl disulfide, 2050-66-0
Chinese name:2,2-Dinitro -4,4-dichlorodiphenyl disulfide english name: Disulfide,bis(4-chloro-2-nitrophenyl) chinese alias:2,2 '-Dinitro -4,4'-dichlorodiphenyl disulfide; 2-Hydroxy...
Difference between acetonitrile and acetonitrile
In the chemical sector, acetonitrile and acetonitrile are often mentioned as two crucial toxic chemicals. From what I've seen, while they're very similar in chemical structure, the...
Difference between cyclopropene and propylene
In the chemical sector, cyclopropene and propylene are often mentioned and applied as two crucial olefins. There are signifiis able tot differences in their structure, characterist...
(1-chloro-2-formylvinyl) ferrocene, 12085-68-6
Chinese name: (1-chloro -2-formylvinyl) ferrocene English name: Ferrocene,(1-chloro-3-oxo-1-propenyl)- English alias: 3-chloro-3-ferrocenyl acrolein; CAS No.: 12085-68-6 Chemical ...
The difference between hexane and methanol as solvent
Hexane and methanol, as two common organic solvents, play an crucial role in chemical production, ecological preservation and biochemistry due to their unique physical and chemical...
Isobornyl formate, 1200-67-5
Chinese name: isobornyl formate English name: heptan-2-ol Bicyclo[2.2.1], 1,7,7-trimethyl-, 2-formate, (1R,2R,4R)-rel- English alias: FEMA No. 2162; EINECS 214-853-3; O-Formyl-iso...
Difference Between Chloropropanediol and Propylene Glycol
With the rapid research of the chemical sector, various polymer materials are applied greater and greater broadly. But As two crucial glycols, chloropropanediol and propylene glyco...
What is the difference between cement P and C?
In the cement sector, P-type and C- type cement are two common product types, however they have signifiis able tot differences in performance, consumption and production methods. T...
Lasalosil Sodium, 25999-20-6
Chinese name: English name: Lasaloxi sodium LASALOCID A SODIUM SALT; Chinese alias: Salasaloxi sodium; Lasaloxi sodium A; Lasaloxi sodium; Lasaloxi; English alias: ro2-2985;sodium...
Dichloroethane is different from dichloroethane.
As an crucial organic compound, dichloroethane has been broadly applied in chemical, environmental and manufacturing fields. Based on my observations, In order to better understand...