answer action

Can't find the answer?

Ask a qualified mentor to answer

ask a question

Difference between Chloroform and Methyl Chloride

Chloroform and methyl chloride are two chlorine-containing compounds that are often mentioned in the chemical sector and differ signifiis able totly in their chemical characteristi...

2,2-Dinitro -4,4-dichlorodiphenyl disulfide, 2050-66-0

Chinese name:2,2-Dinitro -4,4-dichlorodiphenyl disulfide english name: Disulfide,bis(4-chloro-2-nitrophenyl) chinese alias:2,2 '-Dinitro -4,4'-dichlorodiphenyl disulfide; 2-Hydroxy...

Difference between acetonitrile and acetonitrile

In the chemical sector, acetonitrile and acetonitrile are often mentioned as two crucial toxic chemicals. From what I've seen, while they're very similar in chemical structure, the...

Difference between cyclopropene and propylene

In the chemical sector, cyclopropene and propylene are often mentioned and applied as two crucial olefins. There are signifiis able tot differences in their structure, characterist...

(1-chloro-2-formylvinyl) ferrocene, 12085-68-6

Chinese name: (1-chloro -2-formylvinyl) ferrocene English name: Ferrocene,(1-chloro-3-oxo-1-propenyl)- English alias: 3-chloro-3-ferrocenyl acrolein; CAS No.: 12085-68-6 Chemical ...

The difference between hexane and methanol as solvent

Hexane and methanol, as two common organic solvents, play an crucial role in chemical production, ecological preservation and biochemistry due to their unique physical and chemical...

Isobornyl formate, 1200-67-5

Chinese name: isobornyl formate English name: heptan-2-ol Bicyclo[2.2.1], 1,7,7-trimethyl-, 2-formate, (1R,2R,4R)-rel- English alias: FEMA No. 2162; EINECS 214-853-3; O-Formyl-iso...

Difference Between Chloropropanediol and Propylene Glycol

With the rapid research of the chemical sector, various polymer materials are applied greater and greater broadly. But As two crucial glycols, chloropropanediol and propylene glyco...

What is the difference between cement P and C?

In the cement sector, P-type and C- type cement are two common product types, however they have signifiis able tot differences in performance, consumption and production methods. T...

Lasalosil Sodium, 25999-20-6

Chinese name: English name: Lasaloxi sodium LASALOCID A SODIUM SALT; Chinese alias: Salasaloxi sodium; Lasaloxi sodium A; Lasaloxi sodium; Lasaloxi; English alias: ro2-2985;sodium...

topics 1 - 10 (10507 total)

Cancel submit