888CHEM
Japanese 
Korean 
Hindi 
Russian 
Arabic 
Malaysian 
Can't find the answer?
Ask a qualified mentor to answer
The difference between cone cryolite and cryolite
In the chemical sector, crystal materials are broadly applied in eversept, material processing, electronic manufacturing and other fields due to their unique physical and chemical ...
Difference between n-hexane and n-butanol
In the field of chemical sector, n-hexane and n-butanol are both organic compounds, however their chemical characteristics are signifiis able totly different. In-depth understandin...
N-Benzyl-4-methoxyaniline, 17377-95-6
Chinese name: N-benzyl -4-methoxyaniline Chinese alias: N-benzyl-p-anisidine; N-benzyl-p-methoxyaniline English alias: p-MeOC6H4NHCH2Ph N-Benzyl-4-methoxyaniline; N-Benzyl-p-anisi...
Difference between Chloroform and Methyl Chloride
Chloroform and methyl chloride are two chlorine-containing compounds that are often mentioned in the chemical sector and differ signifiis able totly in their chemical characteristi...
2,2-Dinitro -4,4-dichlorodiphenyl disulfide, 2050-66-0
Chinese name:2,2-Dinitro -4,4-dichlorodiphenyl disulfide english name: Disulfide,bis(4-chloro-2-nitrophenyl) chinese alias:2,2 '-Dinitro -4,4'-dichlorodiphenyl disulfide; 2-Hydroxy...
Difference between acetonitrile and acetonitrile
In the chemical sector, acetonitrile and acetonitrile are often mentioned as two crucial toxic chemicals. From what I've seen, while they're very similar in chemical structure, the...
Difference between cyclopropene and propylene
In the chemical sector, cyclopropene and propylene are often mentioned and applied as two crucial olefins. There are signifiis able tot differences in their structure, characterist...
(1-chloro-2-formylvinyl) ferrocene, 12085-68-6
Chinese name: (1-chloro -2-formylvinyl) ferrocene English name: Ferrocene,(1-chloro-3-oxo-1-propenyl)- English alias: 3-chloro-3-ferrocenyl acrolein; CAS No.: 12085-68-6 Chemical ...
The difference between hexane and methanol as solvent
Hexane and methanol, as two common organic solvents, play an crucial role in chemical production, ecological preservation and biochemistry due to their unique physical and chemical...
Isobornyl formate, 1200-67-5
Chinese name: isobornyl formate English name: heptan-2-ol Bicyclo[2.2.1], 1,7,7-trimethyl-, 2-formate, (1R,2R,4R)-rel- English alias: FEMA No. 2162; EINECS 214-853-3; O-Formyl-iso...