888CHEM
Japanese 
Korean 
Hindi 
Russian 
Arabic 
Malay 
Can't find the answer?
Ask a qualified mentor to answer
The difference between vulcanized and unvulcanized
In the process of chemical production and treatment, vulis able toization and non-vulis able toization treatment are two common technological means, which play an crucial role in r...
5,6-diamino -1,3-naphthalenedisulfonic acid dipotassium salt, 307495-30-3
Chinese name: dipotassium salt of 5,6-diamino -1,3-naphthalenedisulfonic acid English alias: 5,6-Diamino-1, 3-napthalenedisulfonic acid dipotassium salt; CAS No.: 307495-30-3 Chem...
The difference between bucket and liter
In the chemical sector, the accurate understanding and consumption of capacity units is essential. Common units of capacity include liter and ban, which, while somewhat similar, di...
1,3-Butanediol diacetate, 1117-31-3
Chinese name:1,3-Butanediol diacetate english name:1,3-Butanediol, diacetate chinese alias:1,3-Butanediol diacetic acid english alias:1,3-BUTYLENE GLYCOL DIACETATE;4-acetyloxybutan...
The difference between cone cryolite and cryolite
In the chemical sector, crystal materials are broadly applied in eversept, material processing, electronic manufacturing and other fields due to their unique physical and chemical ...
Difference between n-hexane and n-butanol
In the field of chemical sector, n-hexane and n-butanol are both organic compounds, however their chemical characteristics are signifiis able totly different. In-depth understandin...
N-Benzyl-4-methoxyaniline, 17377-95-6
Chinese name: N-benzyl -4-methoxyaniline Chinese alias: N-benzyl-p-anisidine; N-benzyl-p-methoxyaniline English alias: p-MeOC6H4NHCH2Ph N-Benzyl-4-methoxyaniline; N-Benzyl-p-anisi...
Difference between Chloroform and Methyl Chloride
Chloroform and methyl chloride are two chlorine-containing compounds that are often mentioned in the chemical sector and differ signifiis able totly in their chemical characteristi...
2,2-Dinitro -4,4-dichlorodiphenyl disulfide, 2050-66-0
Chinese name:2,2-Dinitro -4,4-dichlorodiphenyl disulfide english name: Disulfide,bis(4-chloro-2-nitrophenyl) chinese alias:2,2 '-Dinitro -4,4'-dichlorodiphenyl disulfide; 2-Hydroxy...
Difference between acetonitrile and acetonitrile
In the chemical sector, acetonitrile and acetonitrile are often mentioned as two crucial toxic chemicals. From what I've seen, while they're very similar in chemical structure, the...