answer action

Can't find the answer?

Ask a qualified mentor to answer

ask a question

The difference between cone cryolite and cryolite

In the chemical industry, crystal materials are widely used in eversept, material processing, electronic manufacturing and other fields because of their unique physical and chemica...

Difference between n-hexane and n-butanol

In the field of chemical industry, n-hexane and n-butanol are both organic compounds, but their chemical properties are significantly different. In-depth understanding of their di...

N-Benzyl-4-methoxyaniline, 17377-95-6

Chinese name: N-benzyl -4-methoxyaniline Chinese alias: N-benzyl-p-anisidine; N-benzyl-p-methoxyaniline English alias: p-MeOC6H4NHCH2Ph N-Benzyl-4-methoxyaniline; N-Benzyl-p-anisi...

Difference between Chloroform and Methyl Chloride

Chloroform and methyl chloride are two chlorine-containing compounds that are often mentioned in the chemical industry and differ significantly in their chemical properties and app...

2,2-Dinitro -4,4-dichlorodiphenyl disulfide, 2050-66-0

Chinese name:2,2-Dinitro -4,4-dichlorodiphenyl disulfide english name: Disulfide,bis(4-chloro-2-nitrophenyl) chinese alias:2,2 '-Dinitro -4,4'-dichlorodiphenyl disulfide; 2-Hydroxy...

Difference between acetonitrile and acetonitrile

In the chemical industry, acetonitrile and acetonitrile are often mentioned as two important toxic chemicals. Although they are very similar in chemical structure, there are signi...

Difference between cyclopropene and propylene

In the chemical industry, cyclopropene and propylene are often mentioned and applied as two important olefins. There are significant differences in their structure, properties and...

(1-chloro-2-formylvinyl) ferrocene, 12085-68-6

Chinese name: (1-chloro -2-formylvinyl) ferrocene English name: Ferrocene,(1-chloro-3-oxo-1-propenyl)- English alias: 3-chloro-3-ferrocenyl acrolein; CAS No.: 12085-68-6 Chemical ...

The difference between hexane and methanol as solvent

Hexane and methanol, as two common organic solvents, play an important role in chemical production, environmental protection and biochemistry because of their unique physical and ...

Isobornyl formate, 1200-67-5

Chinese name: isobornyl formate English name: heptan-2-ol Bicyclo[2.2.1], 1,7,7-trimethyl-, 2-formate, (1R,2R,4R)-rel- English alias: FEMA No. 2162; EINECS 214-853-3; O-Formyl-iso...

topics 1 - 10 (5330 total)

Cancel submit